1H-Pyrazolium,5-hydroxy-1,1-dimethyl-3-phenyl-, inner salt structure
|
Common Name | 1H-Pyrazolium,5-hydroxy-1,1-dimethyl-3-phenyl-, inner salt | ||
|---|---|---|---|---|
| CAS Number | 29707-10-6 | Molecular Weight | 188.22600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2-dimethyl-5-phenyl-1H-pyrazol-2-ium-3-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H12N2O |
|---|---|
| Molecular Weight | 188.22600 |
| Exact Mass | 188.09500 |
| PSA | 35.42000 |
| LogP | 1.14700 |
| InChIKey | YWGZXMILMQEKTP-UHFFFAOYSA-O |
| SMILES | C[N+]1(C)NC(c2ccccc2)=CC1=O |
|
~90%
1H-Pyrazolium,5... CAS#:29707-10-6 |
| Literature: Ellis, Jerry W.; Keiter, Ellen A.; Keiter, Richard L.; Li, Tso-Ping; Uptmor, Robert A. Journal of Heterocyclic Chemistry, 1982 , vol. 19, p. 1215 - 1216 |
|
~%
1H-Pyrazolium,5... CAS#:29707-10-6 |
| Literature: Ebner, Sieglinde; Wallfisch, Bianca; Andraos, John; Aitbaev, Ilyas; Kiselewsky, Michael; Bernhardt, Paul V.; Kollenz, Gert; Wentrup, Curt Organic and Biomolecular Chemistry, 2003 , vol. 1, # 14 p. 2550 - 2555 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Pyrazolium,5-hydroxy-1,1-dimethyl-3-phenyl-,hydroxide,inner salt |
| 1,1-dimethyl-3-phenylpyrazolium-5-oxide |