1,3-adamantanedicarbonyl dichloride structure
|
Common Name | 1,3-adamantanedicarbonyl dichloride | ||
|---|---|---|---|---|
| CAS Number | 29713-15-3 | Molecular Weight | 261.14400 | |
| Density | 1.441 | Boiling Point | 318ºC at 760 mmHg | |
| Molecular Formula | C12H14Cl2O2 | Melting Point | 89-90ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | adamantane-1,3-dicarbonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.441 |
|---|---|
| Boiling Point | 318ºC at 760 mmHg |
| Melting Point | 89-90ºC |
| Molecular Formula | C12H14Cl2O2 |
| Molecular Weight | 261.14400 |
| Exact Mass | 260.03700 |
| PSA | 34.14000 |
| LogP | 3.10380 |
| Vapour Pressure | 0.000372mmHg at 25°C |
| Index of Refraction | 1.586 |
| InChIKey | LKRUZYNPJUZODM-UHFFFAOYSA-N |
| SMILES | O=C(Cl)C12CC3CC(C1)CC(C(=O)Cl)(C3)C2 |
|
~97%
1,3-adamantaned... CAS#:29713-15-3 |
| Literature: Klaic, Lada; Aleskovic, Marija; Veljkovic, Jelena; Mlinaric-Majerski, Kata Journal of Physical Organic Chemistry, 2008 , vol. 21, # 4 p. 299 - 305 |
|
~%
1,3-adamantaned... CAS#:29713-15-3 |
| Literature: Asian Journal of Chemistry, , vol. 25, # 7 p. 4119 - 4120 |
| 1,3-Adamantanedicarbonyl chloride |
| adamantane-1,3-dicarboxylic acid dichloride |
| adamantane-1,3-dicarbonyl dichloride |
| 1,3-adamantane dicarbonyl dichloride |
| 1,3-diadamantanedicarbonyl dichloride |
| 1,3-Ad(COCl)2 |
| 1,3-adamantanedicarbonyl dichloride |