1H-benzo[g][3,1]benzoxazine-2,4-dione structure
|
Common Name | 1H-benzo[g][3,1]benzoxazine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 29753-32-0 | Molecular Weight | 213.18900 | |
| Density | 1.417g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H7NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1H-benzo[g][3,1]benzoxazine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.417g/cm3 |
|---|---|
| Molecular Formula | C12H7NO3 |
| Molecular Weight | 213.18900 |
| Exact Mass | 213.04300 |
| PSA | 63.07000 |
| LogP | 1.63450 |
| Index of Refraction | 1.68 |
| InChIKey | ZFOZSUKBPRAEMD-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c2cc3ccccc3cc2c(=O)o1 |
|
~95%
1H-benzo[g][3,1... CAS#:29753-32-0 |
| Literature: Liang, Jing Lu; Park, So-Eun; Kwon, Youngjoo; Jahng, Yurngdong Bioorganic and Medicinal Chemistry, 2012 , vol. 20, # 16 p. 4962 - 4967 |
|
~%
1H-benzo[g][3,1... CAS#:29753-32-0 |
| Literature: SMITHKLINE BEECHAM CORPORATION Patent: WO2009/20990 A1, 2009 ; Location in patent: Page/Page column 69 ; WO 2009/020990 A1 |
|
~%
1H-benzo[g][3,1... CAS#:29753-32-0 |
| Literature: Kumar; Reddy Synthetic Communications, 1992 , vol. 22, # 17 p. 2499 - 2508 |
| 2H-naphtho[2,3-d][1,3]oxazine-2,4(1H)-dione |
| 2H-naphth<2,3-d><3,1>oxazine-2,4(1H)-dione |
| 2H-naphth[2,3-d][1,3]oxazine-2,4(1H)-dione |
| benzisatoic acid anhydride |
| 2H-naphth<2,3-d><3,1>oxazin-2,4(1H)-dione |
| 1H-naphtho[2,3-d][1,3]oxazine-2,4-dione |