OTAVA-BB BB7216050514 structure
|
Common Name | OTAVA-BB BB7216050514 | ||
|---|---|---|---|---|
| CAS Number | 29771-66-2 | Molecular Weight | 228.67500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H13ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-Chlorophenoxy)-2-methylpropanohydrazide |
|---|
| Molecular Formula | C10H13ClN2O2 |
|---|---|
| Molecular Weight | 228.67500 |
| Exact Mass | 228.06700 |
| PSA | 64.35000 |
| LogP | 2.57850 |
| InChIKey | HHDXKYSLBTXCGP-UHFFFAOYSA-N |
| SMILES | CC(C)(Oc1ccc(Cl)cc1)C(=O)NN |
| HS Code | 2928000090 |
|---|
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |