9-Benzylacridine
Modify Date: 2026-02-20 14:25:36
9-Benzylacridine structure
|
Common Name | 9-Benzylacridine | ||
|---|---|---|---|---|
| CAS Number | 2978-79-2 | Molecular Weight | 269.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H15N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 9-Benzylacridine |
|---|
| Molecular Formula | C20H15N |
|---|---|
| Molecular Weight | 269.3 |
| InChIKey | OIJCRZOIUQVWEH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=C3C=CC=CC3=NC4=CC=CC=C42 |
|
Name: Lipopholic-hydrophilic balance, Rm of the compound by reversed-phase chromatography
Source: ChEMBL
Target: N/A
External Id: CHEMBL3282633
|
|
Name: Dissociation constant, basic pKa of the compound by UV spectrophotometry
Source: ChEMBL
Target: N/A
External Id: CHEMBL3282632
|
|
Name: Antitumor activity against mouse L1210 cells transfected in ip dosed C3H/DBA2 F1 mous...
Source: ChEMBL
Target: L1210
External Id: CHEMBL3282634
|
Total 3, Current Page 1 of 1
1