1H-Imidazole,5-[[(phenylmethyl)thio]methyl]-, hydrochloride (1:1) structure
|
Common Name | 1H-Imidazole,5-[[(phenylmethyl)thio]methyl]-, hydrochloride (1:1) | ||
|---|---|---|---|---|
| CAS Number | 29786-71-8 | Molecular Weight | 240.75200 | |
| Density | 1.212g/cm3 | Boiling Point | 413.5ºC at 760mmHg | |
| Molecular Formula | C11H13ClN2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.9ºC | |
| Name | 5-(benzylsulfanylmethyl)-1H-imidazole,hydrochloride |
|---|
| Density | 1.212g/cm3 |
|---|---|
| Boiling Point | 413.5ºC at 760mmHg |
| Molecular Formula | C11H13ClN2S |
| Molecular Weight | 240.75200 |
| Flash Point | 203.9ºC |
| Exact Mass | 240.04900 |
| PSA | 53.98000 |
| LogP | 3.64510 |
| Vapour Pressure | 1.15E-06mmHg at 25°C |
| Index of Refraction | 1.641 |
| InChIKey | RTPLLCMGAABYQV-UHFFFAOYSA-N |
| SMILES | Cl.c1ccc(CSCc2cnc[nH]2)cc1 |
|
~68%
1H-Imidazole,5-... CAS#:29786-71-8 |
| Literature: Street, J. P.; Skorey, K. I.; Brown, R. S.; Ball, R. G. Journal of the American Chemical Society, 1985 , vol. 107, # 25 p. 7669 - 7679 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |