4-(isocyanomethyl)-N,N-dimethylaniline
Modify Date: 2025-09-15 20:00:35
4-(isocyanomethyl)-N,N-dimethylaniline structure
|
Common Name | 4-(isocyanomethyl)-N,N-dimethylaniline | ||
|---|---|---|---|---|
| CAS Number | 2980-89-4 | Molecular Weight | 160.22 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H12N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(isocyanomethyl)-N,N-dimethylaniline |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H12N2 |
|---|---|
| Molecular Weight | 160.22 |
| InChIKey | NRIKGROMDFBYKI-UHFFFAOYSA-N |
| SMILES | [C-]#[N+]Cc1ccc(N(C)C)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 4-(isocyanomethyl)-N,N-dimethylaniline? |
| A: Molecular weight of 4-(isocyanomethyl)-N,N-dimethylaniline is 160.22. |
| Q: What is the SMILES notation of 4-(isocyanomethyl)-N,N-dimethylaniline? |
| A: SMILES notation of 4-(isocyanomethyl)-N,N-dimethylaniline is [C-]#[N+]Cc1ccc(N(C)C)cc1. |
| Q: What is the English name of 4-(isocyanomethyl)-N,N-dimethylaniline? |
| A: The English name of 4-(isocyanomethyl)-N,N-dimethylaniline is 4-(isocyanomethyl)-N,N-dimethylaniline. |
| Q: What is the molecular formula of 4-(isocyanomethyl)-N,N-dimethylaniline? |
| A: Molecular formula of 4-(isocyanomethyl)-N,N-dimethylaniline is C10H12N2. |
| Q: What is the CAS number of 4-(isocyanomethyl)-N,N-dimethylaniline? |
| A: CAS number of 4-(isocyanomethyl)-N,N-dimethylaniline is 2980-89-4. |
| Q: What is the InChIKey of 4-(isocyanomethyl)-N,N-dimethylaniline? |
| A: InChIKey of 4-(isocyanomethyl)-N,N-dimethylaniline is NRIKGROMDFBYKI-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2980-89-4? |
| A: Chinese name of 2980-89-4 is 2980-89-4. |