MALONIC ACID, BUTYL-, ETHYL ESTER structure
|
Common Name | MALONIC ACID, BUTYL-, ETHYL ESTER | ||
|---|---|---|---|---|
| CAS Number | 2985-32-2 | Molecular Weight | 188.22100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | butylmalonic acid monoethyl ester |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H16O4 |
|---|---|
| Molecular Weight | 188.22100 |
| Exact Mass | 188.10500 |
| PSA | 63.60000 |
| LogP | 1.44050 |
| InChIKey | IGGGSAHINVSGTM-UHFFFAOYSA-M |
| SMILES | CCCCC(C(=O)[O-])C(=O)OCC |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 3 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| malonicacid,butyl-,ethylester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of butylmalonic acid monoethyl ester? |
| A: SMILES notation of butylmalonic acid monoethyl ester is CCCCC(C(=O)[O-])C(=O)OCC. |
| Q: What is the molecular formula of butylmalonic acid monoethyl ester? |
| A: Molecular formula of butylmalonic acid monoethyl ester is C9H16O4. |
| Q: What is the InChIKey of butylmalonic acid monoethyl ester? |
| A: InChIKey of butylmalonic acid monoethyl ester is IGGGSAHINVSGTM-UHFFFAOYSA-M. |
| Q: What is the LogP of butylmalonic acid monoethyl ester? |
| A: LogP of butylmalonic acid monoethyl ester is 1.44050. |
| Q: What is the Chinese name of 2985-32-2? |
| A: Chinese name of 2985-32-2 is 2985-32-2. |
| Q: What is the polar surface area (PSA) of butylmalonic acid monoethyl ester? |
| A: Polar surface area (PSA) of butylmalonic acid monoethyl ester is 63.60000. |
| Q: What is the molecular weight of butylmalonic acid monoethyl ester? |
| A: Molecular weight of butylmalonic acid monoethyl ester is 188.22100. |
| Q: What are the downstream products of butylmalonic acid monoethyl ester? |
| A: Related downstream products(CAS) of butylmalonic acid monoethyl ester: 615-96-3;3618-37-9;66181-56-4. |
| Q: What is the CAS number of butylmalonic acid monoethyl ester? |
| A: CAS number of butylmalonic acid monoethyl ester is 2985-32-2. |
| Q: What is the English name of butylmalonic acid monoethyl ester? |
| A: The English name of butylmalonic acid monoethyl ester is butylmalonic acid monoethyl ester. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |