1-[1-(2,4-Dinitrophenyl)hydrazin-1-yl]pentane-2,3-dione
Modify Date: 2026-07-08 17:28:41
![1-[1-(2,4-Dinitrophenyl)hydrazin-1-yl]pentane-2,3-dione Structure](https://www.chemsrc.com/extcaspic/353/29903-86-4.png)
1-[1-(2,4-Dinitrophenyl)hydrazin-1-yl]pentane-2,3-dione structure
|
Common Name | 1-[1-(2,4-Dinitrophenyl)hydrazin-1-yl]pentane-2,3-dione | ||
|---|---|---|---|---|
| CAS Number | 29903-86-4 | Molecular Weight | 296.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12N4O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-[1-(2,4-Dinitrophenyl)hydrazin-1-yl]pentane-2,3-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H12N4O6 |
|---|---|
| Molecular Weight | 296.24 |
| InChIKey | ZKAHTWONYCTMDL-UHFFFAOYSA-N |
| SMILES | CCC(=O)C(=O)CN(N)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1-[1-(2,4-Dinitrophenyl)hydrazin-1-yl]pentane-2,3-dione? |
| A: Molecular weight of 1-[1-(2,4-Dinitrophenyl)hydrazin-1-yl]pentane-2,3-dione is 296.24. |
| Q: What is the Chinese name of 29903-86-4? |
| A: Chinese name of 29903-86-4 is 29903-86-4. |
| Q: What is the English name of 1-[1-(2,4-Dinitrophenyl)hydrazin-1-yl]pentane-2,3-dione? |
| A: The English name of 1-[1-(2,4-Dinitrophenyl)hydrazin-1-yl]pentane-2,3-dione is 1-[1-(2,4-Dinitrophenyl)hydrazin-1-yl]pentane-2,3-dione. |
| Q: What is the InChIKey of 1-[1-(2,4-Dinitrophenyl)hydrazin-1-yl]pentane-2,3-dione? |
| A: InChIKey of 1-[1-(2,4-Dinitrophenyl)hydrazin-1-yl]pentane-2,3-dione is ZKAHTWONYCTMDL-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1-[1-(2,4-Dinitrophenyl)hydrazin-1-yl]pentane-2,3-dione? |
| A: Molecular formula of 1-[1-(2,4-Dinitrophenyl)hydrazin-1-yl]pentane-2,3-dione is C11H12N4O6. |
| Q: What is the CAS number of 1-[1-(2,4-Dinitrophenyl)hydrazin-1-yl]pentane-2,3-dione? |
| A: CAS number of 1-[1-(2,4-Dinitrophenyl)hydrazin-1-yl]pentane-2,3-dione is 29903-86-4. |
| Q: What is the SMILES notation of 1-[1-(2,4-Dinitrophenyl)hydrazin-1-yl]pentane-2,3-dione? |
| A: SMILES notation of 1-[1-(2,4-Dinitrophenyl)hydrazin-1-yl]pentane-2,3-dione is CCC(=O)C(=O)CN(N)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-]. |