Benzeneacetaldehyde, a-[2-(4-nitrophenyl)hydrazinylidene]- structure
|
Common Name | Benzeneacetaldehyde, a-[2-(4-nitrophenyl)hydrazinylidene]- | ||
|---|---|---|---|---|
| CAS Number | 29903-87-5 | Molecular Weight | 269.25500 | |
| Density | 1.26g/cm3 | Boiling Point | 445.6ºC at 760mmHg | |
| Molecular Formula | C14H11N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.3ºC | |
| Name | (2E)-2-[(4-nitrophenyl)hydrazinylidene]-2-phenylacetaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 445.6ºC at 760mmHg |
| Molecular Formula | C14H11N3O3 |
| Molecular Weight | 269.25500 |
| Flash Point | 223.3ºC |
| Exact Mass | 269.08000 |
| PSA | 87.28000 |
| LogP | 3.20610 |
| Vapour Pressure | 3.91E-08mmHg at 25°C |
| Index of Refraction | 1.617 |
| InChIKey | LHKDKLRLQHXDLN-PEZBUJJGSA-N |
| SMILES | O=CC(=NNc1ccc([N+](=O)[O-])cc1)c1ccccc1 |
|
~%
Benzeneacetalde... CAS#:29903-87-5 |
| Literature: Crary et al. Journal of the American Chemical Society, 1956 , vol. 78, p. 5584,5586 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Phenyl-glyoxal-1-(4-nitro-phenylhydrazon) |
| 1-Phenyl-glyoxal-1-mono-<4-nitro-phenylhydrazon> |
| phenyl-glyoxal-1-(4-nitro-phenylhydrazone) |
| 2-Phenyl-2-<4-nitro-phenylhydrazono>-acetaldehyd |