1-[([1,1'-biphenyl]-4-ylmethoxy)methyl]-1H-1,2,3-benzotriazole
Modify Date: 2026-08-23 20:18:49
![1-[([1,1'-biphenyl]-4-ylmethoxy)methyl]-1H-1,2,3-benzotriazole Structure](https://image.chemsrc.com/caspic/317/299159-59-4.png)
1-[([1,1'-biphenyl]-4-ylmethoxy)methyl]-1H-1,2,3-benzotriazole structure
|
Common Name | 1-[([1,1'-biphenyl]-4-ylmethoxy)methyl]-1H-1,2,3-benzotriazole | ||
|---|---|---|---|---|
| CAS Number | 299159-59-4 | Molecular Weight | 315.36800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H17N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-[([1,1'-biphenyl]-4-ylmethoxy)methyl]-1H-1,2,3-benzotriazole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H17N3O |
|---|---|
| Molecular Weight | 315.36800 |
| Exact Mass | 315.13700 |
| PSA | 39.94000 |
| LogP | 4.27260 |
| InChIKey | GKMNKVBETYLTAP-UHFFFAOYSA-N |
| SMILES | c1ccc(-c2ccc(COCn3nnc4ccccc43)cc2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1-[([1,1'-biphenyl]-4-ylmethoxy)methyl]-1H-1,2,3-benzotriazole? |
| A: The English name of 1-[([1,1'-biphenyl]-4-ylmethoxy)methyl]-1H-1,2,3-benzotriazole is 1-[([1,1'-biphenyl]-4-ylmethoxy)methyl]-1H-1,2,3-benzotriazole. |
| Q: What is the molecular weight of 1-[([1,1'-biphenyl]-4-ylmethoxy)methyl]-1H-1,2,3-benzotriazole? |
| A: Molecular weight of 1-[([1,1'-biphenyl]-4-ylmethoxy)methyl]-1H-1,2,3-benzotriazole is 315.36800. |
| Q: What is the Chinese name of 299159-59-4? |
| A: Chinese name of 299159-59-4 is 299159-59-4. |
| Q: What is the CAS number of 1-[([1,1'-biphenyl]-4-ylmethoxy)methyl]-1H-1,2,3-benzotriazole? |
| A: CAS number of 1-[([1,1'-biphenyl]-4-ylmethoxy)methyl]-1H-1,2,3-benzotriazole is 299159-59-4. |
| Q: What is the molecular formula of 1-[([1,1'-biphenyl]-4-ylmethoxy)methyl]-1H-1,2,3-benzotriazole? |
| A: Molecular formula of 1-[([1,1'-biphenyl]-4-ylmethoxy)methyl]-1H-1,2,3-benzotriazole is C20H17N3O. |
| Q: What is the InChIKey of 1-[([1,1'-biphenyl]-4-ylmethoxy)methyl]-1H-1,2,3-benzotriazole? |
| A: InChIKey of 1-[([1,1'-biphenyl]-4-ylmethoxy)methyl]-1H-1,2,3-benzotriazole is GKMNKVBETYLTAP-UHFFFAOYSA-N. |
| Q: What is the LogP of 1-[([1,1'-biphenyl]-4-ylmethoxy)methyl]-1H-1,2,3-benzotriazole? |
| A: LogP of 1-[([1,1'-biphenyl]-4-ylmethoxy)methyl]-1H-1,2,3-benzotriazole is 4.27260. |
| Q: What is the SMILES notation of 1-[([1,1'-biphenyl]-4-ylmethoxy)methyl]-1H-1,2,3-benzotriazole? |
| A: SMILES notation of 1-[([1,1'-biphenyl]-4-ylmethoxy)methyl]-1H-1,2,3-benzotriazole is c1ccc(-c2ccc(COCn3nnc4ccccc43)cc2)cc1. |
| Q: What is the polar surface area (PSA) of 1-[([1,1'-biphenyl]-4-ylmethoxy)methyl]-1H-1,2,3-benzotriazole? |
| A: Polar surface area (PSA) of 1-[([1,1'-biphenyl]-4-ylmethoxy)methyl]-1H-1,2,3-benzotriazole is 39.94000. |