7-Hydroxy-6-methoxy-3-prenylcoumarin
7-Hydroxy-6-methoxy-3-prenylcoumarin structure
|
Common Name | 7-Hydroxy-6-methoxy-3-prenylcoumarin | ||
|---|---|---|---|---|
| CAS Number | 299159-90-3 | Molecular Weight | 260.285 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 445.9±45.0 °C at 760 mmHg | |
| Molecular Formula | C15H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167.7±22.2 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 7-hydroxy-6-methoxy-3-(3-methylbut-2-enyl)chromen-2-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 445.9±45.0 °C at 760 mmHg |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.285 |
| Flash Point | 167.7±22.2 °C |
| Exact Mass | 260.104858 |
| PSA | 59.67000 |
| LogP | 4.04 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.569 |
| InChIKey | LICOULHBERNBDF-UHFFFAOYSA-N |
| SMILES | COc1cc2cc(CC=C(C)C)c(=O)oc2cc1O |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2932209090 |
|---|
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2932209090 |
|---|---|
| Summary | 2932209090. other lactones. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 7-Hydroxy-6-methoxy-3-(3-methyl-2-buten-1-yl)-2H-chromen-2-one |
| W1290 |
| 7-Hydroxy-6-methoxy-3-prenylcoumarin |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 7-hydroxy-6-methoxy-3-(3-methylbut-2-enyl)chromen-2-one? |
| A: The English name of 7-hydroxy-6-methoxy-3-(3-methylbut-2-enyl)chromen-2-one is 7-hydroxy-6-methoxy-3-(3-methylbut-2-enyl)chromen-2-one. |
| Q: What is the molecular formula of 7-hydroxy-6-methoxy-3-(3-methylbut-2-enyl)chromen-2-one? |
| A: Molecular formula of 7-hydroxy-6-methoxy-3-(3-methylbut-2-enyl)chromen-2-one is C15H16O4. |
| Q: What is the CAS number of 7-hydroxy-6-methoxy-3-(3-methylbut-2-enyl)chromen-2-one? |
| A: CAS number of 7-hydroxy-6-methoxy-3-(3-methylbut-2-enyl)chromen-2-one is 299159-90-3. |
| Q: What English synonyms does 7-hydroxy-6-methoxy-3-(3-methylbut-2-enyl)chromen-2-one have? |
| A: English synonyms of 7-hydroxy-6-methoxy-3-(3-methylbut-2-enyl)chromen-2-one: 7-Hydroxy-6-methoxy-3-(3-methyl-2-buten-1-yl)-2H-chromen-2-one, W1290, 7-Hydroxy-6-methoxy-3-prenylcoumarin. |
| Q: What is the polar surface area (PSA) of 7-hydroxy-6-methoxy-3-(3-methylbut-2-enyl)chromen-2-one? |
| A: Polar surface area (PSA) of 7-hydroxy-6-methoxy-3-(3-methylbut-2-enyl)chromen-2-one is 59.67000. |
| Q: What is the molecular weight of 7-hydroxy-6-methoxy-3-(3-methylbut-2-enyl)chromen-2-one? |
| A: Molecular weight of 7-hydroxy-6-methoxy-3-(3-methylbut-2-enyl)chromen-2-one is 260.285. |
| Q: What is the LogP of 7-hydroxy-6-methoxy-3-(3-methylbut-2-enyl)chromen-2-one? |
| A: LogP of 7-hydroxy-6-methoxy-3-(3-methylbut-2-enyl)chromen-2-one is 4.04. |
| Q: What is the InChIKey of 7-hydroxy-6-methoxy-3-(3-methylbut-2-enyl)chromen-2-one? |
| A: InChIKey of 7-hydroxy-6-methoxy-3-(3-methylbut-2-enyl)chromen-2-one is LICOULHBERNBDF-UHFFFAOYSA-N. |
| Q: What is the boiling point of 7-hydroxy-6-methoxy-3-(3-methylbut-2-enyl)chromen-2-one? |
| A: Boiling point of 7-hydroxy-6-methoxy-3-(3-methylbut-2-enyl)chromen-2-one is 445.9±45.0 °C at 760 mmHg. |
| Q: What is the SMILES notation of 7-hydroxy-6-methoxy-3-(3-methylbut-2-enyl)chromen-2-one? |
| A: SMILES notation of 7-hydroxy-6-methoxy-3-(3-methylbut-2-enyl)chromen-2-one is COc1cc2cc(CC=C(C)C)c(=O)oc2cc1O. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| BioBioPha |
| Dayang Chem (Hangzhou) Co., Ltd. |
| naturewill |