Benzonitrile,4-[(3-ethyl-4-oxo-2-thioxo-5-thiazolidinylidene)methyl]- structure
|
Common Name | Benzonitrile,4-[(3-ethyl-4-oxo-2-thioxo-5-thiazolidinylidene)methyl]- | ||
|---|---|---|---|---|
| CAS Number | 29947-09-9 | Molecular Weight | 274.36100 | |
| Density | 1.4g/cm3 | Boiling Point | 448.8ºC at 760 mmHg | |
| Molecular Formula | C13H10N2OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.2ºC | |
| Name | 4-[(Z)-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]benzonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4g/cm3 |
|---|---|
| Boiling Point | 448.8ºC at 760 mmHg |
| Molecular Formula | C13H10N2OS2 |
| Molecular Weight | 274.36100 |
| Flash Point | 225.2ºC |
| Exact Mass | 274.02300 |
| PSA | 101.49000 |
| LogP | 2.71728 |
| Vapour Pressure | 3.01E-08mmHg at 25°C |
| Index of Refraction | 1.703 |
| InChIKey | POWQQQIAHKMUPI-XFFZJAGNSA-N |
| SMILES | CCN1C(=O)C(=Cc2ccc(C#N)cc2)SC1=S |
|
~%
Benzonitrile,4-... CAS#:29947-09-9 |
| Literature: Allan,F.J.; Allan,G.G. Journal of Heterocyclic Chemistry, 1970 , vol. 7, p. 1091 - 1094 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-(3-ethyl-4-oxo-2-thioxo-thiazolidin-5-ylidenemethyl)-benzonitrile |
| 4-[(Z)-(3-ethyl-4-oxo-2-thioxo-1,3-thiazolidin-5-ylidene)methyl]benzonitrile |
| 3-Aethyl-5-(4-Cyanophenylmethylen)-rhodanin |