Benzoic acid,4-[[4-oxo-3-(2-propen-1-yl)-2-thioxo-5-thiazolidinylidene]methyl]- structure
|
Common Name | Benzoic acid,4-[[4-oxo-3-(2-propen-1-yl)-2-thioxo-5-thiazolidinylidene]methyl]- | ||
|---|---|---|---|---|
| CAS Number | 29947-13-5 | Molecular Weight | 305.37200 | |
| Density | 1.46g/cm3 | Boiling Point | 494.9ºC at 760 mmHg | |
| Molecular Formula | C14H11NO3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 253.1ºC | |
| Name | 4-[(Z)-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]benzoic acid |
|---|
| Density | 1.46g/cm3 |
|---|---|
| Boiling Point | 494.9ºC at 760 mmHg |
| Molecular Formula | C14H11NO3S2 |
| Molecular Weight | 305.37200 |
| Flash Point | 253.1ºC |
| Exact Mass | 305.01800 |
| PSA | 115.00000 |
| LogP | 2.70990 |
| Vapour Pressure | 1.3E-10mmHg at 25°C |
| Index of Refraction | 1.718 |
| InChIKey | LOJZMWZBNYOZJW-FLIBITNWSA-N |
| SMILES | C=CCN1C(=O)C(=Cc2ccc(C(=O)O)cc2)SC1=S |
|
~98%
Benzoic acid,4-... CAS#:29947-13-5 |
| Literature: Nitsche, Christoph; Schreier, Verena N.; Behnam, Mira A. M.; Kumar, Anil; Bartenschlager, Ralf; Klein, Christian D. Journal of Medicinal Chemistry, 2013 , vol. 56, # 21 p. 8389 - 8403 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |