Rhodanine,5,5'-(p-phenylenedimethylidyne)bis[3-allyl- (8CI) structure
|
Common Name | Rhodanine,5,5'-(p-phenylenedimethylidyne)bis[3-allyl- (8CI) | ||
|---|---|---|---|---|
| CAS Number | 29947-15-7 | Molecular Weight | 444.61300 | |
| Density | 1.46g/cm3 | Boiling Point | 598.5ºC at 760mmHg | |
| Molecular Formula | C20H16N2O2S4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 315.7ºC | |
| Name | (5E)-5-[[4-[(E)-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl]methylidene]-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.46g/cm3 |
|---|---|
| Boiling Point | 598.5ºC at 760mmHg |
| Molecular Formula | C20H16N2O2S4 |
| Molecular Weight | 444.61300 |
| Flash Point | 315.7ºC |
| Exact Mass | 444.00900 |
| PSA | 155.40000 |
| LogP | 4.33680 |
| Vapour Pressure | 2.77E-14mmHg at 25°C |
| Index of Refraction | 1.761 |
| InChIKey | NMVRBCWOLLAFBI-JOBJLJCHSA-N |
| SMILES | C=CCN1C(=O)C(=Cc2ccc(C=C3SC(=S)N(CC=C)C3=O)cc2)SC1=S |
|
~%
Rhodanine,5,5'-... CAS#:29947-15-7 |
| Literature: Allan,F.J.; Allan,G.G. Journal of Heterocyclic Chemistry, 1970 , vol. 7, p. 1091 - 1094 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3,3'-diallyl-2,2'-dithioxo-5,5'-p-phenylenebismethylene-bis-thiazolidin-4-one |