Benzaldehyde,4-[(4-oxo-2-thioxo-5-thiazolidinylidene)methyl]-
Modify Date: 2025-09-19 14:44:11
![Benzaldehyde,4-[(4-oxo-2-thioxo-5-thiazolidinylidene)methyl]- Structure](https://image.chemsrc.com/caspic/314/29947-17-9.png)
Benzaldehyde,4-[(4-oxo-2-thioxo-5-thiazolidinylidene)methyl]- structure
|
Common Name | Benzaldehyde,4-[(4-oxo-2-thioxo-5-thiazolidinylidene)methyl]- | ||
|---|---|---|---|---|
| CAS Number | 29947-17-9 | Molecular Weight | 249.30900 | |
| Density | 1.48g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H7NO2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]benzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.48g/cm3 |
|---|---|
| Molecular Formula | C11H7NO2S2 |
| Molecular Weight | 249.30900 |
| Exact Mass | 248.99200 |
| PSA | 103.56000 |
| LogP | 2.31670 |
| Index of Refraction | 1.728 |
| InChIKey | QSCTZTIMXSIZQE-UITAMQMPSA-N |
| SMILES | O=Cc1ccc(C=C2SC(=S)NC2=O)cc1 |
|
~%
Benzaldehyde,4-... CAS#:29947-17-9 |
| Literature: Allan,F.J.; Allan,G.G. Journal of Heterocyclic Chemistry, 1970 , vol. 7, p. 1091 - 1094 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-(4-oxo-2-thioxo-thiazolidin-5-ylidenemethyl)-benzaldehyde |
| 5-(4-Formyl-phenylmethylene)-rhodanine |