Benzaldehyde,4-[[4-oxo-3-(2-propen-1-yl)-2-thioxo-5-thiazolidinylidene]methyl]- structure
|
Common Name | Benzaldehyde,4-[[4-oxo-3-(2-propen-1-yl)-2-thioxo-5-thiazolidinylidene]methyl]- | ||
|---|---|---|---|---|
| CAS Number | 29947-18-0 | Molecular Weight | 289.37300 | |
| Density | 1.37g/cm3 | Boiling Point | 455.5ºC at 760mmHg | |
| Molecular Formula | C14H11NO2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.2ºC | |
| Name | 4-[(Z)-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]benzaldehyde |
|---|
| Density | 1.37g/cm3 |
|---|---|
| Boiling Point | 455.5ºC at 760mmHg |
| Molecular Formula | C14H11NO2S2 |
| Molecular Weight | 289.37300 |
| Flash Point | 229.2ºC |
| Exact Mass | 289.02300 |
| PSA | 94.77000 |
| LogP | 2.82420 |
| Vapour Pressure | 1.75E-08mmHg at 25°C |
| Index of Refraction | 1.692 |
| InChIKey | YYKZHHPAGZSXRI-WQLSENKSSA-N |
| SMILES | C=CCN1C(=O)C(=Cc2ccc(C=O)cc2)SC1=S |
|
~%
Benzaldehyde,4-... CAS#:29947-18-0 |
| Literature: Allan,F.J.; Allan,G.G. Journal of Heterocyclic Chemistry, 1970 , vol. 7, p. 1091 - 1094 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |