Pentanoic acid,1-methyl-1,2-ethanediyl ester (9CI) structure
|
Common Name | Pentanoic acid,1-methyl-1,2-ethanediyl ester (9CI) | ||
|---|---|---|---|---|
| CAS Number | 29949-05-1 | Molecular Weight | 244.32700 | |
| Density | 0.975g/cm3 | Boiling Point | 303.4ºC at 760 mmHg | |
| Molecular Formula | C13H24O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 139ºC | |
| Name | 2-pentanoyloxypropyl pentanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.975g/cm3 |
|---|---|
| Boiling Point | 303.4ºC at 760 mmHg |
| Molecular Formula | C13H24O4 |
| Molecular Weight | 244.32700 |
| Flash Point | 139ºC |
| Exact Mass | 244.16700 |
| PSA | 52.60000 |
| LogP | 2.84170 |
| Vapour Pressure | 0.00093mmHg at 25°C |
| Index of Refraction | 1.438 |
| InChIKey | YQXQGZJZISGSBK-UHFFFAOYSA-N |
| SMILES | CCCCC(=O)OCC(C)OC(=O)CCCC |
|
~%
Pentanoic acid,... CAS#:29949-05-1 |
| Literature: Lewis, J. I.; Subrahmanyam, V. V. R. Journal of the Indian Chemical Society, 1983 , vol. 60, p. 1062 - 1064 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1,2-Propandioldivaleriat |
| propane-1,2-diyl dipentanoate |