2-Fluoro-1-iodo-4-nitrobenzene structure
|
Common Name | 2-Fluoro-1-iodo-4-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 2996-30-7 | Molecular Weight | 266.996 | |
| Density | 2.1±0.1 g/cm3 | Boiling Point | 291.5±25.0 °C at 760 mmHg | |
| Molecular Formula | C6H3FINO2 | Melting Point | 129-130ºC | |
| MSDS | N/A | Flash Point | 130.1±23.2 °C | |
| Name | 2-fluoro-1-iodo-4-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 2.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 291.5±25.0 °C at 760 mmHg |
| Melting Point | 129-130ºC |
| Molecular Formula | C6H3FINO2 |
| Molecular Weight | 266.996 |
| Flash Point | 130.1±23.2 °C |
| Exact Mass | 266.919250 |
| PSA | 45.82000 |
| LogP | 2.83 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.635 |
| InChIKey | QLAFWGDKYKHVKC-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(I)c(F)c1 |
| HS Code | 2904909090 |
|---|
|
~%
2-Fluoro-1-iodo... CAS#:2996-30-7 |
| Literature: Journal of Organic Chemistry, , vol. 25, p. 996 - 1000 |
|
~%
2-Fluoro-1-iodo... CAS#:2996-30-7 |
| Literature: Journal of Organic Chemistry, , vol. 25, p. 996 - 1000 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 3-Fluor-4-iod-1-nitro-benzol |
| MFCD00033987 |
| 2-Fluoro-1-iodo-4-nitrobenzene |
| Benzene, 2-fluoro-1-iodo-4-nitro- |
| 3-Fluoro-4-iodonitrobenzene |
| 3-FLUORO-4-IODO NITROBENZENE |