2-bromo-4-methyl-6-(5-phenyl-1,2-oxazol-3-ylidene)cyclohexa-2,4-dien-1-one structure
|
Common Name | 2-bromo-4-methyl-6-(5-phenyl-1,2-oxazol-3-ylidene)cyclohexa-2,4-dien-1-one | ||
|---|---|---|---|---|
| CAS Number | 29976-90-7 | Molecular Weight | 330.17600 | |
| Density | 1.455g/cm3 | Boiling Point | 432.703ºC at 760 mmHg | |
| Molecular Formula | C16H12BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.491ºC | |
| Name | 2-bromo-4-methyl-6-(5-phenyl-1,2-oxazol-3-ylidene)cyclohexa-2,4-dien-1-one |
|---|
| Density | 1.455g/cm3 |
|---|---|
| Boiling Point | 432.703ºC at 760 mmHg |
| Molecular Formula | C16H12BrNO2 |
| Molecular Weight | 330.17600 |
| Flash Point | 215.491ºC |
| Exact Mass | 329.00500 |
| PSA | 46.00000 |
| LogP | 3.51430 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.625 |
| InChIKey | SUZYJJOKEWQMAD-UHFFFAOYSA-N |
| SMILES | Cc1cc(Br)c(O)c(-c2cc(-c3ccccc3)on2)c1 |
|
~%
2-bromo-4-methy... CAS#:29976-90-7 |
| Literature: Borkhade,K.T.; Marathey,M.G. Indian Journal of Chemistry, 1970 , vol. 8, p. 796 - 800 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |