1,2,3-Benzotriazin-4(3H)-one,3-(4-nitrophenyl) structure
|
Common Name | 1,2,3-Benzotriazin-4(3H)-one,3-(4-nitrophenyl) | ||
|---|---|---|---|---|
| CAS Number | 29980-76-5 | Molecular Weight | 268.22800 | |
| Density | 1.49g/cm3 | Boiling Point | 479ºC at 760mmHg | |
| Molecular Formula | C13H8N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.5ºC | |
| Name | 3-(4-nitrophenyl)-1,2,3-benzotriazin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.49g/cm3 |
|---|---|
| Boiling Point | 479ºC at 760mmHg |
| Molecular Formula | C13H8N4O3 |
| Molecular Weight | 268.22800 |
| Flash Point | 243.5ºC |
| Exact Mass | 268.06000 |
| PSA | 93.60000 |
| LogP | 2.21210 |
| Vapour Pressure | 2.46E-09mmHg at 25°C |
| Index of Refraction | 1.727 |
| InChIKey | NRKBYFNSSNFOGE-UHFFFAOYSA-N |
| SMILES | O=c1c2ccccc2nnn1-c1ccc([N+](=O)[O-])cc1 |
|
~%
1,2,3-Benzotria... CAS#:29980-76-5 |
| Literature: Pytela, Oldrich; Dlouhy, Vladimir Collection of Czechoslovak Chemical Communications, 1990 , vol. 55, # 10 p. 2468 - 2474 |
| 3-(4-nitrophenyl)-1,2,3-benzotriazin-4(3h)-one |
| 3-(p-Nitro-phenyl)-3,4-dihydro-1,2,3-benzotriazinon-(4) |
| 3-(p-Nitrophenyl)-1,2,3-benzotriazin-4(3H)-on |
| 3,4-Dihydro-3-p-nitrophenyl-4-oxo-1,2,3-benzotriazin |
| 3-p-Nitrophenyl-1,2,3-benzotriazin-4-on |
| 3-(4-nitro-phenyl)-3H-benzo[d][1,2,3]triazin-4-one |
| 3-(4-Nitrophenyl)-4-oxo-3,4-dihydro-1,2,3-benzotriazin |