Acetamide,N-(3-amino-1,4-dihydro-1,4-dioxo-2-naphthalenyl)-2-chloro- structure
|
Common Name | Acetamide,N-(3-amino-1,4-dihydro-1,4-dioxo-2-naphthalenyl)-2-chloro- | ||
|---|---|---|---|---|
| CAS Number | 30007-59-1 | Molecular Weight | 264.66400 | |
| Density | 1.49g/cm3 | Boiling Point | 471.5ºC at 760mmHg | |
| Molecular Formula | C12H9ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239ºC | |
| Name | N-(3-amino-1,4-dioxonaphthalen-2-yl)-2-chloroacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.49g/cm3 |
|---|---|
| Boiling Point | 471.5ºC at 760mmHg |
| Molecular Formula | C12H9ClN2O3 |
| Molecular Weight | 264.66400 |
| Flash Point | 239ºC |
| Exact Mass | 264.03000 |
| PSA | 89.26000 |
| LogP | 1.68210 |
| Index of Refraction | 1.649 |
| InChIKey | GZTAVGHNOAGXQS-UHFFFAOYSA-N |
| SMILES | NC1=C(NC(=O)CCl)C(=O)c2ccccc2C1=O |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Acetamide,N-(3-amino-1,4-dihydro-1,4-dioxo-2-naphthalenyl)-2-chloro |
| Acetamide,N-(3-amino-1,4-dihydro-1,4-dioxo-2-naphthyl)-2-chloro-(8CI) |
| N-(3-AMINO-1,4-DIOXO-NAPHTHALEN-2-YL)-2-CHLORO-ACETAMIDE |