1-(4-Cyclopropyl-phenyl)-2-methylamino-ethanol; compound with cyclohexyl-sulfamic acid structure
|
Common Name | 1-(4-Cyclopropyl-phenyl)-2-methylamino-ethanol; compound with cyclohexyl-sulfamic acid | ||
|---|---|---|---|---|
| CAS Number | 30010-74-3 | Molecular Weight | 370.50700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H30N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-Cyclopropyl-phenyl)-2-methylamino-ethanol; compound with cyclohexyl-sulfamic acid |
|---|
| Molecular Formula | C18H30N2O4S |
|---|---|
| Molecular Weight | 370.50700 |
| Exact Mass | 370.19300 |
| PSA | 107.04000 |
| LogP | 4.39090 |
| InChIKey | RTFMUIDCVVXJOT-UHFFFAOYSA-N |
| SMILES | C[NH2+]CC(O)c1ccc(C2CC2)cc1.O=S(=O)([O-])NC1CCCCC1 |