2-Methyl-4,5-bis(4-methoxyphenyl)-1H-pyrrole structure
|
Common Name | 2-Methyl-4,5-bis(4-methoxyphenyl)-1H-pyrrole | ||
|---|---|---|---|---|
| CAS Number | 30011-11-1 | Molecular Weight | 293.36000 | |
| Density | 1.117g/cm3 | Boiling Point | 432.2ºC at 760 mmHg | |
| Molecular Formula | C19H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 155.7ºC | |
| Name | 2,3-bis(4-methoxyphenyl)-5-methyl-1H-pyrrole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.117g/cm3 |
|---|---|
| Boiling Point | 432.2ºC at 760 mmHg |
| Molecular Formula | C19H19NO2 |
| Molecular Weight | 293.36000 |
| Flash Point | 155.7ºC |
| Exact Mass | 293.14200 |
| PSA | 34.25000 |
| LogP | 4.67430 |
| Index of Refraction | 1.585 |
| InChIKey | WABWKXZHYGHSCI-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2cc(C)[nH]c2-c2ccc(OC)cc2)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Bimetopyrol |