N,N,N-Tributyl-1-butanaminium 4-nitrophenolate structure
|
Common Name | N,N,N-Tributyl-1-butanaminium 4-nitrophenolate | ||
|---|---|---|---|---|
| CAS Number | 3002-48-0 | Molecular Weight | 380.565 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H40N2O3 | Melting Point | 145 °C | |
| MSDS | N/A | Flash Point | N/A | |
Use of N,N,N-Tributyl-1-butanaminium 4-nitrophenolateTetrabutylammonium p-Nitrophenoxide is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | 4-nitrophenolate,tetrabutylazanium |
|---|---|
| Synonym | More Synonyms |
| Description | Tetrabutylammonium p-Nitrophenoxide is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Melting Point | 145 °C |
|---|---|
| Molecular Formula | C22H40N2O3 |
| Molecular Weight | 380.565 |
| Exact Mass | 380.303894 |
| PSA | 68.88000 |
| LogP | 7.26540 |
| InChIKey | JWRHOHUAHHYNBL-UHFFFAOYSA-M |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.O=[N+]([O-])c1ccc([O-])cc1 |
| HS Code | 2923900090 |
|---|
|
~%
N,N,N-Tributyl-... CAS#:3002-48-0 |
| Literature: Gale, Philip A.; Twyman, Lance J.; Handlin, Cristin I.; Sessler, Jonathan L. Chemical Communications, 1999 , # 18 p. 1851 - 1852 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2923900090 |
|---|---|
| Summary | 2923900090 other quaternary ammonium salts and hydroxides。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| tetra-n-butylammonium p-nitrophenoxide |
| N,N,N-Tributylbutan-1-aminium 4-nitrophenolate |
| Tetrabutylammonium p-Nitrophenoxide |
| TETRABUTYLAMMONIUM 4-NITROPHENOLATE |
| 4-nitro-phenol,tetrabutylammonium salt |
| Bu4N p-nitrophenolate |
| tetrabutylammonium p-nitro-phenolate |
| N,N,N-Tributyl-1-butanaminium 4-nitrophenolate |