Benzenamine,4,4'-methylenebis[N-ethyl-2-methyl
Modify Date: 2025-09-02 15:23:42
Benzenamine,4,4'-methylenebis[N-ethyl-2-methyl structure
|
Common Name | Benzenamine,4,4'-methylenebis[N-ethyl-2-methyl | ||
|---|---|---|---|---|
| CAS Number | 3003-95-0 | Molecular Weight | 282.42300 | |
| Density | 1.033g/cm3 | Boiling Point | 441.6ºC at 760 mmHg | |
| Molecular Formula | C19H26N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 267.5ºC | |
| Name | N-ethyl-4-[[4-(ethylamino)-3-methylphenyl]methyl]-2-methylaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.033g/cm3 |
|---|---|
| Boiling Point | 441.6ºC at 760 mmHg |
| Molecular Formula | C19H26N2 |
| Molecular Weight | 282.42300 |
| Flash Point | 267.5ºC |
| Exact Mass | 282.21000 |
| PSA | 24.06000 |
| LogP | 4.90380 |
| Index of Refraction | 1.601 |
| InChIKey | LELNERYBQGXVST-UHFFFAOYSA-N |
| SMILES | CCNc1ccc(Cc2ccc(NCC)c(C)c2)cc1C |
| HS Code | 2921590090 |
|---|
|
~%
Benzenamine,4,4... CAS#:3003-95-0 |
| Literature: Friedlaender; Dinesmann Monatshefte fuer Chemie, 1898 , vol. 19, p. 631 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2921590090 |
|---|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
Total 2, Current Page 1 of 1
1
| 4.4'-Bis-aethylamino-3.3'-dimethyl-diphenylmethan |
| bis-(4-ethylamino-3-methyl-phenyl)-methane |
| 4,4'-methanediylbis(n-ethyl-2-methylaniline) |
| Bis-<4-aethylamino-3-methyl-phenyl>-methan |