1,3,2,4-Dithiadiphosphetane,2,4-bis(4-ethoxyphenyl)-, 2,4-disulfide structure
|
Common Name | 1,3,2,4-Dithiadiphosphetane,2,4-bis(4-ethoxyphenyl)-, 2,4-disulfide | ||
|---|---|---|---|---|
| CAS Number | 30043-13-1 | Molecular Weight | 432.52000 | |
| Density | 1.42g/cm3 | Boiling Point | 545ºC at 760 mmHg | |
| Molecular Formula | C16H18O2P2S4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 283.4ºC | |
| Name | 2,4-bis(4-ethoxyphenyl)-2,4-bis(sulfanylidene)-1,3,2λ5,4λ5-dithiadiphosphetane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.42g/cm3 |
|---|---|
| Boiling Point | 545ºC at 760 mmHg |
| Molecular Formula | C16H18O2P2S4 |
| Molecular Weight | 432.52000 |
| Flash Point | 283.4ºC |
| Exact Mass | 431.96600 |
| PSA | 152.86000 |
| LogP | 6.83500 |
| Index of Refraction | 1.68 |
| InChIKey | HOTVPVSJJQCMAX-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(P2(=S)SP(=S)(c3ccc(OCC)cc3)S2)cc1 |
|
~%
1,3,2,4-Dithiad... CAS#:30043-13-1 |
| Literature: Lecher et al. Journal of the American Chemical Society, 1956 , vol. 78, p. 5018,5021 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| phenetylperthiophosphinic acid anhydride dimer |