Acetamide,N-(5-amino-1,6-dihydro-6-oxo-2-pyrimidinyl)- structure
|
Common Name | Acetamide,N-(5-amino-1,6-dihydro-6-oxo-2-pyrimidinyl)- | ||
|---|---|---|---|---|
| CAS Number | 3005-73-0 | Molecular Weight | 168.15300 | |
| Density | 1.59g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C6H8N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(5-amino-6-oxo-1H-pyrimidin-2-yl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.59g/cm3 |
|---|---|
| Molecular Formula | C6H8N4O2 |
| Molecular Weight | 168.15300 |
| Exact Mass | 168.06500 |
| PSA | 100.87000 |
| Index of Refraction | 1.69 |
| InChIKey | SWSJNIANKBKVCR-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ncc(N)c(=O)[nH]1 |
| HS Code | 2933599090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Acetamido-5-amino-4-hydroxy-pyrimidin |
| 5-Amino-2-acetylamino-4-hydroxy-pyrimidine |
| 2-acetylamino-5-amino-3H-pyrimidin-4-one |