4H-Pyrrolo[2,3-d]pyrimidin-4-one,3,7-dihydro-3-b-D-ribofuranosyl- structure
|
Common Name | 4H-Pyrrolo[2,3-d]pyrimidin-4-one,3,7-dihydro-3-b-D-ribofuranosyl- | ||
|---|---|---|---|---|
| CAS Number | 30066-71-8 | Molecular Weight | 267.23800 | |
| Density | 1.9g/cm3 | Boiling Point | 647ºC at 760mmHg | |
| Molecular Formula | C11H13N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 345.1ºC | |
| Name | 3-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7H-pyrrolo[2,3-d]pyrimidin-4-one |
|---|
| Density | 1.9g/cm3 |
|---|---|
| Boiling Point | 647ºC at 760mmHg |
| Molecular Formula | C11H13N3O5 |
| Molecular Weight | 267.23800 |
| Flash Point | 345.1ºC |
| Exact Mass | 267.08600 |
| PSA | 120.60000 |
| Index of Refraction | 1.81 |
| InChIKey | NAAKMAJWNQZIRD-UHFFFAOYSA-N |
| SMILES | O=c1c2cc[nH]c2ncn1C1OC(CO)C(O)C1O |
|
~%
4H-Pyrrolo[2,3-... CAS#:30066-71-8 |
| Literature: Patil, Vemanna D.; Wise, Dean S.; Wotring, Linda L.; Bloomer, Linda C.; Townsend, Leroy B. Journal of Medicinal Chemistry, 1985 , vol. 28, # 4 p. 423 - 427 |
|
~%
4H-Pyrrolo[2,3-... CAS#:30066-71-8 |
| Literature: Patil, Vemanna D.; Wise, Dean S.; Wotring, Linda L.; Bloomer, Linda C.; Townsend, Leroy B. Journal of Medicinal Chemistry, 1985 , vol. 28, # 4 p. 423 - 427 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |