2-(4-fluorobenzoyl)-1-benzofuran-5-carbaldehyde structure
|
Common Name | 2-(4-fluorobenzoyl)-1-benzofuran-5-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 300664-74-8 | Molecular Weight | 268.23900 | |
| Density | 1.338g/cm3 | Boiling Point | 430.5ºC at 760 mmHg | |
| Molecular Formula | C16H9FO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.1ºC | |
| Name | 2-(4-fluorobenzoyl)-1-benzofuran-5-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.338g/cm3 |
|---|---|
| Boiling Point | 430.5ºC at 760 mmHg |
| Molecular Formula | C16H9FO3 |
| Molecular Weight | 268.23900 |
| Flash Point | 214.1ºC |
| Exact Mass | 268.05400 |
| PSA | 47.28000 |
| LogP | 3.61540 |
| Index of Refraction | 1.648 |
| InChIKey | QZUPNKHXOIBWRD-UHFFFAOYSA-N |
| SMILES | O=Cc1ccc2oc(C(=O)c3ccc(F)cc3)cc2c1 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(4-Fluoro-benzoyl)-benzofuran-5-carbaldehyde |