5-Methoxy-2-phenyl-1-benzofuran-3-carboxylic acid
Modify Date: 2025-09-20 21:21:33
5-Methoxy-2-phenyl-1-benzofuran-3-carboxylic acid structure
|
Common Name | 5-Methoxy-2-phenyl-1-benzofuran-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 300674-03-7 | Molecular Weight | 268.26400 | |
| Density | 1.288g/cm3 | Boiling Point | 438ºC at 760 mmHg | |
| Molecular Formula | C16H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.7ºC | |
| Name | 5-Methoxy-2-phenyl-1-benzofuran-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.288g/cm3 |
|---|---|
| Boiling Point | 438ºC at 760 mmHg |
| Molecular Formula | C16H12O4 |
| Molecular Weight | 268.26400 |
| Flash Point | 218.7ºC |
| Exact Mass | 268.07400 |
| PSA | 59.67000 |
| LogP | 3.80660 |
| Index of Refraction | 1.635 |
| InChIKey | ZAWWFXRAMMHWMM-UHFFFAOYSA-N |
| SMILES | COc1ccc2oc(-c3ccccc3)c(C(=O)O)c2c1 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Methoxy-2-phenyl-benzofuran-3-carbonsaeure |
| 5-methoxy-2-phenyl-benzofuran-3-carboxylic acid |