Amino(3-nitrophenyl)acetic acid structure
|
Common Name | Amino(3-nitrophenyl)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 30077-08-8 | Molecular Weight | 196.160 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 370.3±37.0 °C at 760 mmHg | |
| Molecular Formula | C8H8N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.7±26.5 °C | |
| Name | 2-amino-2-(3-nitrophenyl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 370.3±37.0 °C at 760 mmHg |
| Molecular Formula | C8H8N2O4 |
| Molecular Weight | 196.160 |
| Flash Point | 177.7±26.5 °C |
| Exact Mass | 196.048401 |
| PSA | 109.14000 |
| LogP | 0.67 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.631 |
| InChIKey | RJMYTHGQVJWWJO-UHFFFAOYSA-N |
| SMILES | NC(C(=O)O)c1cccc([N+](=O)[O-])c1 |
| HS Code | 2922499990 |
|---|
|
~%
Amino(3-nitroph... CAS#:30077-08-8 |
| Literature: Ploechl; Loe Chemische Berichte, 1885 , vol. 18, p. 1181 |
|
~%
Amino(3-nitroph... CAS#:30077-08-8 |
| Literature: Smith, Grant Gill; Sivakua, Thipamon Journal of Organic Chemistry, 1983 , vol. 48, # 5 p. 627 - 634 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| Amino(3-nitrophenyl)acetic acid |
| Benzeneacetic acid, α-amino-3-nitro- |
| m-nitrophenylglycine |
| DL-m-Nitrophenylglycine |
| m-nitro-D,L-phenylglycine |