Isoxazole,3-methyl-5-phenyl-4-(2-phenyldiazenyl)- structure
|
Common Name | Isoxazole,3-methyl-5-phenyl-4-(2-phenyldiazenyl)- | ||
|---|---|---|---|---|
| CAS Number | 30082-03-2 | Molecular Weight | 263.29400 | |
| Density | 1.17g/cm3 | Boiling Point | 456.9ºC at 760 mmHg | |
| Molecular Formula | C16H13N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 230.1ºC | |
| Name | (3-methyl-5-phenyl-1,2-oxazol-4-yl)-phenyldiazene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 456.9ºC at 760 mmHg |
| Molecular Formula | C16H13N3O |
| Molecular Weight | 263.29400 |
| Flash Point | 230.1ºC |
| Exact Mass | 263.10600 |
| PSA | 50.75000 |
| LogP | 5.06540 |
| Index of Refraction | 1.621 |
| InChIKey | LSTKIGHUFIJZML-UHFFFAOYSA-N |
| SMILES | Cc1noc(-c2ccccc2)c1N=Nc1ccccc1 |
|
~%
Isoxazole,3-met... CAS#:30082-03-2 |
| Literature: Garg; Singh Journal of medicinal chemistry, 1970 , vol. 13, # 6 p. 1250 - 1251 |
|
~%
Isoxazole,3-met... CAS#:30082-03-2 |
| Literature: Garg,H.G. Journal of the Indian Chemical Society, 1963 , vol. 40, p. 135 - 136 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-Benzolazo-3-methyl-5-phenyl-isoxazol |
| 3-Methyl-5-phenyl-4-phenylazo-isoxazol |
| AmbscPOD_03/0594 |
| 3-methyl-5-phenyl-4-phenylazo-isoxazole |