2H-1,3,5-Triazino[1,2-c][1,2,3]benzotriazin-4-amine,2-imino-10-methyl- structure
|
Common Name | 2H-1,3,5-Triazino[1,2-c][1,2,3]benzotriazin-4-amine,2-imino-10-methyl- | ||
|---|---|---|---|---|
| CAS Number | 30101-70-3 | Molecular Weight | 227.22500 | |
| Density | 1.74g/cm3 | Boiling Point | 392.7ºC at 760mmHg | |
| Molecular Formula | C10H9N7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.3ºC | |
| Name | 4-imino-10-methyl-[1,3,5]triazino[1,2-c][1,2,3]benzotriazin-2-amine |
|---|
| Density | 1.74g/cm3 |
|---|---|
| Boiling Point | 392.7ºC at 760mmHg |
| Molecular Formula | C10H9N7 |
| Molecular Weight | 227.22500 |
| Flash Point | 191.3ºC |
| Exact Mass | 227.09200 |
| PSA | 105.84000 |
| LogP | 0.72350 |
| Index of Refraction | 1.902 |
| InChIKey | KJXYFDKLTGXJNA-UHFFFAOYSA-N |
| SMILES | Cc1ccc2nnn3c(=N)nc(N)nc3c2c1 |
| HS Code | 2933699090 |
|---|
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |