1-Triazene,1-[4-(1H-inden-1-ylidenemethyl)phenyl]-3,3-dimethyl- structure
|
Common Name | 1-Triazene,1-[4-(1H-inden-1-ylidenemethyl)phenyl]-3,3-dimethyl- | ||
|---|---|---|---|---|
| CAS Number | 30117-77-2 | Molecular Weight | 275.34800 | |
| Density | 1.07g/cm3 | Boiling Point | 422.2ºC at 760mmHg | |
| Molecular Formula | C18H17N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.2ºC | |
| Name | N-[[4-(inden-1-ylidenemethyl)phenyl]diazenyl]-N-methylmethanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.07g/cm3 |
|---|---|
| Boiling Point | 422.2ºC at 760mmHg |
| Molecular Formula | C18H17N3 |
| Molecular Weight | 275.34800 |
| Flash Point | 209.2ºC |
| Exact Mass | 275.14200 |
| PSA | 27.96000 |
| LogP | 4.81430 |
| Index of Refraction | 1.601 |
| InChIKey | QXOOINPVJXOXFR-QRHXVANRSA-N |
| SMILES | CN(C)N=Nc1ccc(C=C2C=Cc3ccccc32)cc1 |
| HS Code | 2928000090 |
|---|
|
~%
1-Triazene,1-[4... CAS#:30117-77-2 |
| Literature: Bahner,C.T. et al. Journal of Medicinal Chemistry, 1970 , vol. 13, p. 1240 - 1242 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 1-[2-(1-hydroxyethyl)-3-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenoxy]-3-(propan-2-ylamino)propan-2-ol dihydrochloride |