1-Benzyl 3-tert-butyl piperidine-1,3-dicarboxylate structure
|
Common Name | 1-Benzyl 3-tert-butyl piperidine-1,3-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 301180-04-1 | Molecular Weight | 319.39500 | |
| Density | 1.128g/cm3 | Boiling Point | 420ºC at 760 mmHg | |
| Molecular Formula | C18H25NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.8ºC | |
| Name | 1-O-benzyl 3-O-tert-butyl piperidine-1,3-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.128g/cm3 |
|---|---|
| Boiling Point | 420ºC at 760 mmHg |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.39500 |
| Flash Point | 207.8ºC |
| Exact Mass | 319.17800 |
| PSA | 55.84000 |
| LogP | 3.31480 |
| Index of Refraction | 1.526 |
| InChIKey | YGTAGHPPCSNECI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1CCCN(C(=O)OCc2ccccc2)C1 |
| Storage condition | 2-8°C |
| HS Code | 2933399090 |
|---|
|
~96%
1-Benzyl 3-tert... CAS#:301180-04-1 |
| Literature: Abbott Laboratories Patent: US2004/116518 A1, 2004 ; Location in patent: Page 117 ; |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| tert-butyl N-benzyloxycarbonyl nipecotate |
| N-CBZ-3-PIPERIDINECARBOXYLIC ACID TERT-BUTYL ESTER |
| N-Cbz-3-piperidinecarboxylic acid t-butyl ester |