2-(2-diethylaminoethyl)-3-methyl-2-naphthalen-1-yl-butanal structure
|
Common Name | 2-(2-diethylaminoethyl)-3-methyl-2-naphthalen-1-yl-butanal | ||
|---|---|---|---|---|
| CAS Number | 30121-03-0 | Molecular Weight | 311.46100 | |
| Density | 1.002g/cm3 | Boiling Point | 442.1ºC at 760mmHg | |
| Molecular Formula | C21H29NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 155.9ºC | |
| Name | 2-[2-(diethylamino)ethyl]-3-methyl-2-naphthalen-1-ylbutanal |
|---|
| Density | 1.002g/cm3 |
|---|---|
| Boiling Point | 442.1ºC at 760mmHg |
| Molecular Formula | C21H29NO |
| Molecular Weight | 311.46100 |
| Flash Point | 155.9ºC |
| Exact Mass | 311.22500 |
| PSA | 20.31000 |
| LogP | 4.66440 |
| Index of Refraction | 1.548 |
| InChIKey | JWEUZDWBSXAJKG-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCC(C=O)(c1cccc2ccccc12)C(C)C |
| HS Code | 2921499090 |
|---|
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |