4,6-bis(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-amine
Modify Date: 2025-08-26 11:27:40
4,6-bis(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-amine structure
|
Common Name | 4,6-bis(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-amine | ||
|---|---|---|---|---|
| CAS Number | 301211-00-7 | Molecular Weight | 292.13900 | |
| Density | 1.577g/cm3 | Boiling Point | 311.6ºC at 760 mmHg | |
| Molecular Formula | C7H6F6N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 142.3ºC | |
| Name | 4,6-bis(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.577g/cm3 |
|---|---|
| Boiling Point | 311.6ºC at 760 mmHg |
| Molecular Formula | C7H6F6N4O2 |
| Molecular Weight | 292.13900 |
| Flash Point | 142.3ºC |
| Exact Mass | 292.03900 |
| PSA | 83.15000 |
| LogP | 1.91720 |
| Index of Refraction | 1.434 |
| InChIKey | BLRWOTDMVWVIHW-UHFFFAOYSA-N |
| SMILES | Nc1nc(OCC(F)(F)F)nc(OCC(F)(F)F)n1 |
| HS Code | 2933699090 |
|---|
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| hms1577i07 |