2-Benzyl-5-piperidin-4-yl-1,3,4-thiadiazole;hydrochloride
Modify Date: 2025-09-11 11:40:53
2-Benzyl-5-piperidin-4-yl-1,3,4-thiadiazole;hydrochloride structure
|
Common Name | 2-Benzyl-5-piperidin-4-yl-1,3,4-thiadiazole;hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 301221-93-2 | Molecular Weight | 295.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H18ClN3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Benzyl-5-piperidin-4-yl-1,3,4-thiadiazole;hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H18ClN3S |
|---|---|
| Molecular Weight | 295.8 |
| InChIKey | IKUAZERMOKFCGV-UHFFFAOYSA-N |
| SMILES | Cl.c1ccc(Cc2nnc(C3CCNCC3)s2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 2-Benzyl-5-piperidin-4-yl-1,3,4-thiadiazole;hydrochloride? |
| A: The English name of 2-Benzyl-5-piperidin-4-yl-1,3,4-thiadiazole;hydrochloride is 2-Benzyl-5-piperidin-4-yl-1,3,4-thiadiazole;hydrochloride. |
| Q: What is the molecular weight of 2-Benzyl-5-piperidin-4-yl-1,3,4-thiadiazole;hydrochloride? |
| A: Molecular weight of 2-Benzyl-5-piperidin-4-yl-1,3,4-thiadiazole;hydrochloride is 295.8. |
| Q: What is the SMILES notation of 2-Benzyl-5-piperidin-4-yl-1,3,4-thiadiazole;hydrochloride? |
| A: SMILES notation of 2-Benzyl-5-piperidin-4-yl-1,3,4-thiadiazole;hydrochloride is Cl.c1ccc(Cc2nnc(C3CCNCC3)s2)cc1. |
| Q: What is the molecular formula of 2-Benzyl-5-piperidin-4-yl-1,3,4-thiadiazole;hydrochloride? |
| A: Molecular formula of 2-Benzyl-5-piperidin-4-yl-1,3,4-thiadiazole;hydrochloride is C14H18ClN3S. |
| Q: What is the InChIKey of 2-Benzyl-5-piperidin-4-yl-1,3,4-thiadiazole;hydrochloride? |
| A: InChIKey of 2-Benzyl-5-piperidin-4-yl-1,3,4-thiadiazole;hydrochloride is IKUAZERMOKFCGV-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 301221-93-2? |
| A: Chinese name of 301221-93-2 is 301221-93-2. |
| Q: What is the CAS number of 2-Benzyl-5-piperidin-4-yl-1,3,4-thiadiazole;hydrochloride? |
| A: CAS number of 2-Benzyl-5-piperidin-4-yl-1,3,4-thiadiazole;hydrochloride is 301221-93-2. |