Cyclobutanecarbonitrile,1,1'-azobis- (9CI)
Modify Date: 2024-02-01 20:26:33
Cyclobutanecarbonitrile,1,1'-azobis- (9CI) structure
|
Common Name | Cyclobutanecarbonitrile,1,1'-azobis- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 30124-69-7 | Molecular Weight | 188.22900 | |
| Density | 1.25g/cm3 | Boiling Point | 372.3ºC at 760 mmHg | |
| Molecular Formula | C10H12N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 178.9ºC | |
| Name | 1-[(1-cyanocyclobutyl)diazenyl]cyclobutane-1-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 372.3ºC at 760 mmHg |
| Molecular Formula | C10H12N4 |
| Molecular Weight | 188.22900 |
| Flash Point | 178.9ºC |
| Exact Mass | 188.10600 |
| PSA | 72.30000 |
| LogP | 2.33116 |
| Index of Refraction | 1.646 |
| InChIKey | MSYZEPKKOAEGRR-UHFFFAOYSA-N |
| SMILES | N#CC1(N=NC2(C#N)CCC2)CCC1 |
| HS Code | 2927000090 |
|---|
|
~%
Cyclobutanecarb... CAS#:30124-69-7 |
| Literature: Overberger et al. Journal of the American Chemical Society, 1953 , vol. 75, p. 2075 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2927000090 |
|---|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 1,1'-(e)-diazene-1,2-diyldicyclobutanecarbonitrile |
| 1,1'-azo-bis-cyclobutanecarbonitrile |
| 1,1'-Azo-bis-cyclobutancarbonitril |