8-methoxy-2-(4-methylphenyl)-2-(trifluoromethyl)-3H-[1,3,5]triazino[2,1-b][1,3]benzothiazol-4-one structure
|
Common Name | 8-methoxy-2-(4-methylphenyl)-2-(trifluoromethyl)-3H-[1,3,5]triazino[2,1-b][1,3]benzothiazol-4-one | ||
|---|---|---|---|---|
| CAS Number | 301331-96-4 | Molecular Weight | 393.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H14F3N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 8-methoxy-2-(4-methylphenyl)-2-(trifluoromethyl)-3H-[1,3,5]triazino[2,1-b][1,3]benzothiazol-4-one |
|---|
| Molecular Formula | C18H14F3N3O2S |
|---|---|
| Molecular Weight | 393.4 |
| InChIKey | KIEBVYWZYGYIFV-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2(NC(=O)N3C4=C(C=C(C=C4)OC)SC3=N2)C(F)(F)F |
|
Name: Inhibitors of CDC25B-CDK2/CyclinA interaction
Source: Center for Chemical Genomics, University of Michigan
External Id: MScreen:TargetID_600
|
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|