N-[3-[(3-Hydroxyphenyl)amino]-2-quinoxalinyl]benzenesulfonamide
Modify Date: 2025-11-10 01:32:41
![N-[3-[(3-Hydroxyphenyl)amino]-2-quinoxalinyl]benzenesulfonamide Structure](https://image.chemsrc.com/caspic/168/301357-74-4.png)
N-[3-[(3-Hydroxyphenyl)amino]-2-quinoxalinyl]benzenesulfonamide structure
|
Common Name | N-[3-[(3-Hydroxyphenyl)amino]-2-quinoxalinyl]benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 301357-74-4 | Molecular Weight | 392.43 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H16N4O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of N-[3-[(3-Hydroxyphenyl)amino]-2-quinoxalinyl]benzenesulfonamideHIV-IN-6 is a HIV-Ⅰ viral replication inhibitor by targeting Src family kinases (SFK) that interact with Nef protein of the virus, such as Hck[1]. |
| Name | HIV-IN-6 |
|---|
| Description | HIV-IN-6 is a HIV-Ⅰ viral replication inhibitor by targeting Src family kinases (SFK) that interact with Nef protein of the virus, such as Hck[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. Emert-Sedlak, et al. Targeting an hiv-1 nef-host cell kinase complex. |
| Molecular Formula | C20H16N4O3S |
|---|---|
| Molecular Weight | 392.43 |
| InChIKey | BNHZFBKIEIPSHA-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Nc1nc2ccccc2nc1Nc1cccc(O)c1)c1ccccc1 |