(4-Chlorophenyl)(1-methyl-1H-imidazol-2-yl)methanone structure
|
Common Name | (4-Chlorophenyl)(1-methyl-1H-imidazol-2-yl)methanone | ||
|---|---|---|---|---|
| CAS Number | 30148-18-6 | Molecular Weight | 220.65500 | |
| Density | 1.26g/cm3 | Boiling Point | 397ºC at 760 mmHg | |
| Molecular Formula | C11H9ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.9ºC | |
| Name | (4-Chlorophenyl)(1-methyl-1H-imidazol-2-yl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 397ºC at 760 mmHg |
| Molecular Formula | C11H9ClN2O |
| Molecular Weight | 220.65500 |
| Flash Point | 193.9ºC |
| Exact Mass | 220.04000 |
| PSA | 34.89000 |
| LogP | 2.30450 |
| Index of Refraction | 1.611 |
| InChIKey | SDDUQCWOAVSVHV-UHFFFAOYSA-N |
| SMILES | Cn1ccnc1C(=O)c1ccc(Cl)cc1 |
| HS Code | 2933290090 |
|---|
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(4-chlorobenzoyl)-1,3,5-trimethyl-1H-pyrrole |
| 2-p-Chlorbenzoyl-1-methylimidazol |
| Methanone,(4-chlorophenyl)(1,3,5-trimethyl-1H-pyrrol-2-yl) |
| (4-chloro-phenyl)-(1-methyl-1H-imidazol-2-yl)-methanone |
| 2-(4-chlorobenzoyl)-1-methyl-1H-imidazole |
| 2-p-Chlorbenzoyl-1,3,5-trimethylpyrrol |
| 2-(4-chlorobenzoyl)-1,3,5-trimethylpyrrole |
| 4-chlorophenyl 1-methylimidazol-2-yl ketone |
| 2-p-chlorobenzoyl-1,3,5-trimethylpyrrole |