1-[ethoxy(propyl)phosphoryl]oxy-4-nitrobenzene structure
|
Common Name | 1-[ethoxy(propyl)phosphoryl]oxy-4-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 3015-73-4 | Molecular Weight | 273.22200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H16NO5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[ethoxy(propyl)phosphoryl]oxy-4-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H16NO5P |
|---|---|
| Molecular Weight | 273.22200 |
| Exact Mass | 273.07700 |
| PSA | 91.16000 |
| LogP | 4.13640 |
| InChIKey | KFCNNOWWHZLXCJ-UHFFFAOYSA-N |
| SMILES | CCCP(=O)(OCC)Oc1ccc([N+](=O)[O-])cc1 |
|
~%
1-[ethoxy(propy... CAS#:3015-73-4 |
| Literature: Fukuto; Metcalf Journal of the American Chemical Society, 1959 , vol. 81, p. 372,374 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Phosphonic acid,propyl-,ethyl 4-nitrophenyl ester |