Pentylphosphonic acid p-nitrophenylethyl ester structure
|
Common Name | Pentylphosphonic acid p-nitrophenylethyl ester | ||
|---|---|---|---|---|
| CAS Number | 3015-75-6 | Molecular Weight | 301.27500 | |
| Density | 1.182g/cm3 | Boiling Point | 408.1ºC at 760mmHg | |
| Molecular Formula | C13H20NO5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.6ºC | |
| Name | 1-[ethoxy(pentyl)phosphoryl]oxy-4-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.182g/cm3 |
|---|---|
| Boiling Point | 408.1ºC at 760mmHg |
| Molecular Formula | C13H20NO5P |
| Molecular Weight | 301.27500 |
| Flash Point | 200.6ºC |
| Exact Mass | 301.10800 |
| PSA | 91.16000 |
| LogP | 4.91660 |
| Index of Refraction | 1.507 |
| InChIKey | WVEDKNWZBPHSRJ-UHFFFAOYSA-N |
| SMILES | CCCCCP(=O)(OCC)Oc1ccc([N+](=O)[O-])cc1 |
| HS Code | 2931900090 |
|---|
|
~%
Pentylphosphoni... CAS#:3015-75-6 |
| Literature: Fukuto; Metcalf Journal of the American Chemical Society, 1959 , vol. 81, p. 372,374 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Ethyl p-nitrophenyl pentylphosphonate |
| p-Nitrophenyl ethyl pentylphosphonate |
| Phosphonic acid,pentyl-,ethyl p-nitrophenyl ester |