(E)-2-methyl-N-(4-oxo-5-(thiophen-2-ylmethylene)-2-thioxothiazolidin-3-yl)benzamide
Modify Date: 2026-02-08 17:05:42
(E)-2-methyl-N-(4-oxo-5-(thiophen-2-ylmethylene)-2-thioxothiazolidin-3-yl)benzamide structure
|
Common Name | (E)-2-methyl-N-(4-oxo-5-(thiophen-2-ylmethylene)-2-thioxothiazolidin-3-yl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 301692-20-6 | Molecular Weight | 360.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H12N2O2S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (E)-2-methyl-N-(4-oxo-5-(thiophen-2-ylmethylene)-2-thioxothiazolidin-3-yl)benzamide |
|---|
| Molecular Formula | C16H12N2O2S3 |
|---|---|
| Molecular Weight | 360.5 |
| InChIKey | OYHJCPUHVPPBMB-UKTHLTGXSA-N |
| SMILES | CC1=CC=CC=C1C(=O)NN2C(=O)/C(=C\C3=CC=CS3)/SC2=S |
|
Name: Contractile Force Screening of ChemBridge Diverset library for asthma drug discovery
Source: 24015
Target: N/A
External Id: HSPH_Screening_CFS_002
|
Total 1, Current Page 1 of 1
1