4(3H)-Pyrimidinone,2,6-diamino-5-[2-(2,3-dichlorophenyl)diazenyl]-
Modify Date: 2025-08-20 02:51:34
![4(3H)-Pyrimidinone,2,6-diamino-5-[2-(2,3-dichlorophenyl)diazenyl]- Structure](https://image.chemsrc.com/caspic/390/30189-03-8.png)
4(3H)-Pyrimidinone,2,6-diamino-5-[2-(2,3-dichlorophenyl)diazenyl]- structure
|
Common Name | 4(3H)-Pyrimidinone,2,6-diamino-5-[2-(2,3-dichlorophenyl)diazenyl]- | ||
|---|---|---|---|---|
| CAS Number | 30189-03-8 | Molecular Weight | 299.11600 | |
| Density | 1.81g/cm3 | Boiling Point | 471.6ºC at 760 mmHg | |
| Molecular Formula | C10H8Cl2N6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239ºC | |
| Name | (5E)-2,6-diamino-5-[(2,3-dichlorophenyl)hydrazinylidene]pyrimidin-4-one |
|---|
| Density | 1.81g/cm3 |
|---|---|
| Boiling Point | 471.6ºC at 760 mmHg |
| Molecular Formula | C10H8Cl2N6O |
| Molecular Weight | 299.11600 |
| Flash Point | 239ºC |
| Exact Mass | 298.01400 |
| PSA | 122.51000 |
| LogP | 3.81890 |
| Index of Refraction | 1.786 |
| InChIKey | BDSIHSSJXPESGT-UHFFFAOYSA-N |
| SMILES | Nc1nc(N)c(N=Nc2cccc(Cl)c2Cl)c(=O)[nH]1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |