2H,4H-Oxazolo[5,4,3-ij]pyrido[3,2-g]quinolin-4-one, 6,8-dimethyl- structure
|
Common Name | 2H,4H-Oxazolo[5,4,3-ij]pyrido[3,2-g]quinolin-4-one, 6,8-dimethyl- | ||
|---|---|---|---|---|
| CAS Number | 30198-05-1 | Molecular Weight | 252.26800 | |
| Density | 1.4g/cm3 | Boiling Point | 435.8ºC at 760 mmHg | |
| Molecular Formula | C15H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.3ºC | |
| Name | 2H,4H-Oxazolo[5,4,3-ij]pyrido[3,2-g]quinolin-4-one, 6,8-dimethyl |
|---|
| Density | 1.4g/cm3 |
|---|---|
| Boiling Point | 435.8ºC at 760 mmHg |
| Molecular Formula | C15H12N2O2 |
| Molecular Weight | 252.26800 |
| Flash Point | 217.3ºC |
| Exact Mass | 252.09000 |
| PSA | 44.12000 |
| LogP | 2.51640 |
| Index of Refraction | 1.725 |
| InChIKey | VVTDQRIKFHXMGH-UHFFFAOYSA-N |
| SMILES | Cc1ccnc2c3c4c(cc12)c(C)cc(=O)n4CO3 |
|
~%
2H,4H-Oxazolo[5... CAS#:30198-05-1 |
| Literature: Forbis,R.M.; Rinehart,K.L. Journal of the American Chemical Society, 1973 , vol. 95, p. 5003 - 5013 |
|
~%
2H,4H-Oxazolo[5... CAS#:30198-05-1 |
| Literature: Forbis,R.M.; Rinehart,K.L. Journal of the American Chemical Society, 1973 , vol. 95, p. 5003 - 5013 |
|
~%
2H,4H-Oxazolo[5... CAS#:30198-05-1 |
| Literature: Forbis,R.M.; Rinehart,K.L. Journal of the American Chemical Society, 1973 , vol. 95, p. 5003 - 5013 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |