Robinetinidin chloride structure
|
Common Name | Robinetinidin chloride | ||
|---|---|---|---|---|
| CAS Number | 3020-09-5 | Molecular Weight | 322.69700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H11ClO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(3,7-dihydroxychromenylium-2-yl)benzene-1,2,3-triol,chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H11ClO6 |
|---|---|
| Molecular Weight | 322.69700 |
| Exact Mass | 322.02400 |
| PSA | 114.29000 |
| InChIKey | SSFSVCKWRJIXDS-UHFFFAOYSA-N |
| SMILES | Oc1ccc2cc(O)c(-c3cc(O)c(O)c(O)c3)[o+]c2c1.[Cl-] |
| Storage condition | −20°C |
| WGK Germany | 3 |
|---|---|
| HS Code | 2907299090 |
|
~%
Robinetinidin c... CAS#:3020-09-5 |
| Literature: Roux; Freudenberg Justus Liebigs Annalen der Chemie, 1958 , vol. 613, p. 56,60 |
| HS Code | 2907299090 |
|---|---|
| Summary | 2907299090 polyphenols; phenol-alcohols。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |
| Robinetinidin chloride |
| 3,3 inverted exclamation marka,4 inverted exclamation marka,5 inverted exclamation marka,7-Pentahydroxyflavylium chloride |
| Robinetinidin |
| 3,3',4',5',7-Pentahydroxyflavylium chloride |