2-Boc-Aminothiazole-5-carboxylic acid structure
|
Common Name | 2-Boc-Aminothiazole-5-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 302964-02-9 | Molecular Weight | 244.268 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H12N2O4S | Melting Point | 220-222ºC(dec) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Name | 2-[(tert-Butoxycarbonyl)amino]-1,3-thiazole-5-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Melting Point | 220-222ºC(dec) |
| Molecular Formula | C9H12N2O4S |
| Molecular Weight | 244.268 |
| Exact Mass | 244.051773 |
| PSA | 116.76000 |
| LogP | 1.55 |
| Index of Refraction | 1.602 |
| InChIKey | QNFLEDLPOVONCN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)Nc1ncc(C(=O)O)s1 |
| HS Code | 2934100090 |
|---|
|
~99%
2-Boc-Aminothia... CAS#:302964-02-9 |
| Literature: BRISTOL-MYERS SQUIBB COMPANY Patent: WO2009/100171 A1, 2009 ; Location in patent: Page/Page column 109 ; |
|
~%
2-Boc-Aminothia... CAS#:302964-02-9 |
| Literature: WO2011/115758 A1, ; Page/Page column 8 ; |
|
~%
2-Boc-Aminothia... CAS#:302964-02-9 |
| Literature: WO2012/51450 A1, ; Page/Page column 27 ; WO 2012/051450 A1 |
|
~%
2-Boc-Aminothia... CAS#:302964-02-9 |
| Literature: US2003/119811 A1, ; US 20030119811 A1 |
|
~%
2-Boc-Aminothia... CAS#:302964-02-9 |
| Literature: Journal of Medicinal Chemistry, , vol. 49, # 23 p. 6819 - 6832 |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazole-5-carboxylic acid |
| 2-Boc-Aminothiazole-5-carboxylic acid |
| 5-Thiazolecarboxylic acid, 2-[[(1,1-dimethylethoxy)carbonyl]amino]- |
| 2-(N-BOC)-Aminothiazole-5-carboxylic acid |
| 2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-1,3-thiazole-5-carboxylic acid |
| 2-[(tert-Butoxycarbonyl)amino]-1,3-thiazole-5-carboxylic acid |
| 2-N-BOC-AMINO-THIAZOLE-5-CARBOXYLIC ACID |